Why FlumatinibMesylate no impurity

Nov 26, 2018
1.FlumatinibMesylate and intermediates
FlumatinibMesylate 895519-91-2;895519-90-1(free)  intermediate: 637354-25-7
FlumatinibMesylate 895519-91-2;895519-90-1(free)  intermediate: 51984-61-3
FlumatinibMesylate 895519-91-2;895519-90-1(free)  intermediate: 895519-80-9
FlumatinibMesylate 895519-91-2;895519-90-1(free)  intermediate: 895519-81-0
FlumatinibMesylate 895519-91-2;895519-90-1(free)  intermediate: 859282-11-4
FlumatinibMesylate 895519-91-2;895519-90-1(free)  intermediate: 895519-90-1

2.ROS-FlumatinibMesylate


3.
Name: Flumatinib mesylate
CAS#: 895519-91-2;895519-90-1(free)

Synonym: Flumatinib mesylate; HHGV678; HHGV 678 ; HHGV-678; HH-GV-678; Flumatinib;

IUPAC/Chemical Name: N-(6-methyl-5-((4-(pyridin-3-yl)pyrimidin-2-yl)amino)pyridin-3-yl)-4-((4-methylpiperazin-1-yl)methyl)-3-(trifluoromethyl)benzamide mesylate

InChi Key: ZSASDYCFROUKTJ-UHFFFAOYSA-N

InChi Code: InChI=1S/C29H29F3N8O.CH4O3S/c1-19-26(38-28-34-9-7-25(37-28)21-4-3-8-33-16-21)15-23(17-35-19)36-27(41)20-5-6-22(24(14-20)29(30,31)32)18-40-12-10-39(2)11-13-40;1-5(2,3)4/h3-9,14-17H,10-13,18H2,1-2H3,(H,36,41)(H,34,37,38);1H3,(H,2,3,4)

SMILES Code: O=C(NC1=CC(NC2=NC=CC(C3=CC=CN=C3)=N2)=C(C)N=C1)C4=CC=C(CN5CCN(C)CC5)C(C(F)(F)F)=C4.OS(=O)(C)=O

 


 
已经到最底了